ChemNet > CAS > 3678-70-4 Diphenyl-2-pyridylmethane
3678-70-4 Diphenyl-2-pyridylmethane
상품명칭 |
Diphenyl-2-pyridylmethane |
별명 |
2-Diphenylmethylpyridine; 2-benzhydrylpyridine |
분자식 |
C18H15N |
분자량 |
245.3184 |
InChI |
InChI=1/C18H15N/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17/h1-14,18H |
cas번호 |
3678-70-4 |
EC번호 |
222-953-3 |
분자 구조 |
|
밀도 |
1.085g/cm3 |
녹는 점 |
58-61℃ |
비등점 |
359.8°C at 760 mmHg |
굴절 지수 |
1.607 |
인화점 |
153.6°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|