ChemNet > CAS > 368870-06-8 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid
368870-06-8 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid
상품명칭 |
1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid |
별명 |
1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
분자식 |
C13H14ClNO3 |
분자량 |
267.7082 |
InChI |
InChI=1/C13H14ClNO3/c14-11-3-1-9(2-4-11)5-6-15-8-10(13(17)18)7-12(15)16/h1-4,10H,5-8H2,(H,17,18) |
cas번호 |
368870-06-8 |
분자 구조 |
|
밀도 |
1.346g/cm3 |
녹는 점 |
148℃ |
비등점 |
496.6°C at 760 mmHg |
굴절 지수 |
1.588 |
인화점 |
254.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|