3760-11-0 2-Nonenoic acid
상품명칭 |
2-Nonenoic acid |
영문 이름 |
2-Nonenoic acid; trans-2-Nonenoic acid; (2Z)-non-2-enoic acid |
분자식 |
C9H16O2 |
분자량 |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/b8-7- |
cas번호 |
3760-11-0 |
EC번호 |
223-171-5 |
분자 구조 |
|
밀도 |
0.944g/cm3 |
비등점 |
261.5°C at 760 mmHg |
굴절 지수 |
1.46 |
인화점 |
168.3°C |
증기압 |
0.00341mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|