ChemNet > CAS > 3766-55-0 4-Allylthiosemicarbazide
3766-55-0 4-Allylthiosemicarbazide
상품명칭 |
4-Allylthiosemicarbazide |
별명 |
4-Allyl-3-thiosemicarbazide; N-(prop-2-en-1-yl)hydrazinecarbothioamide |
분자식 |
C4H9N3S |
분자량 |
131.1994 |
InChI |
InChI=1/C4H9N3S/c1-2-3-6-4(8)7-5/h2H,1,3,5H2,(H2,6,7,8) |
cas번호 |
3766-55-0 |
EC번호 |
223-186-7 |
분자 구조 |
|
밀도 |
1.131g/cm3 |
녹는 점 |
93-96℃ |
비등점 |
209.8°C at 760 mmHg |
굴절 지수 |
1.575 |
인화점 |
80.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|