ChemNet > CAS > 3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
| 상품명칭 |
Diethyl 1,1-cyclobutanedicarboxylate |
| 별명 |
1,1-Cyclobutanedicarboxylic acid diethyl ester; diethyl cyclobutane-1,1-dicarboxylate; Diethyl-1,1-cyclobutane dicarboxylate |
| 분자식 |
C10H16O4 |
| 분자량 |
200.2316 |
| InChI |
InChI=1/C10H16O4/c1-3-13-8(11)10(6-5-7-10)9(12)14-4-2/h3-7H2,1-2H3 |
| cas번호 |
3779-29-1 |
| EC번호 |
223-239-4 |
| 분자 구조 |
|
| 밀도 |
1.127g/cm3 |
| 비등점 |
224.5°C at 760 mmHg |
| 굴절 지수 |
1.469 |
| 인화점 |
99.7°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
