3853-91-6 Pentamethyliodobenzene
상품명칭 |
Pentamethyliodobenzene |
영문 이름 |
Pentamethyliodobenzene; Iodopentamethylbenzene; 1-iodo-2,3,4,5,6-pentamethylbenzene |
분자식 |
C11H15I |
분자량 |
274.1413 |
InChI |
InChI=1/C11H15I/c1-6-7(2)9(4)11(12)10(5)8(6)3/h1-5H3 |
cas번호 |
3853-91-6 |
EC번호 |
223-360-2 |
분자 구조 |
|
밀도 |
1.421g/cm3 |
녹는 점 |
135-137℃ |
비등점 |
297.9°C at 760 mmHg |
굴절 지수 |
1.57 |
인화점 |
133.7°C |
증기압 |
0.00232mmHg at 25°C |
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|