ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
상품명칭 |
5-Methyl-2-furanmethanol |
별명 |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
분자식 |
C6H8O2 |
분자량 |
112.1265 |
InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
cas번호 |
3857-25-8 |
분자 구조 |
|
밀도 |
1.095g/cm3 |
비등점 |
178.5°C at 760 mmHg |
굴절 지수 |
1.494 |
인화점 |
61.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|