3878-55-5 mono-Methyl succinate
상품명칭 |
mono-Methyl succinate |
영문 이름 |
mono-Methyl succinate; Succinic acid monomethyl ester; methyl hydrogen succinate; mono-Methyl hydrogen succinate; 4-Methoxy-4-oxobutanoic acid; 4-methoxy-4-oxobutanoate |
분자식 |
C5H7O4 |
분자량 |
131.1072 |
InChI |
InChI=1/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7)/p-1 |
cas번호 |
3878-55-5 |
EC번호 |
223-408-2 |
분자 구조 |
|
녹는 점 |
55-59℃ |
비등점 |
259.2°C at 760 mmHg |
인화점 |
104.5°C |
증기압 |
0.00394mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|