394-35-4 methyl 2-fluorobenzoate
| 상품명칭 |
methyl 2-fluorobenzoate |
| 영문 이름 |
methyl 2-fluorobenzoate; 2-Fluorobenzoic acid methyl ester |
| 분자식 |
C8H7FO2 |
| 분자량 |
154.14 |
| InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| cas번호 |
394-35-4 |
| EC번호 |
206-894-0 |
| 분자 구조 |
|
| 밀도 |
1.21 |
| 비등점 |
99℃ (18 torr) |
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|