ChemNet > CAS > 3943-73-5 ethyl 2,3-dihydroxybenzoate
3943-73-5 ethyl 2,3-dihydroxybenzoate
| 상품명칭 |
ethyl 2,3-dihydroxybenzoate |
| 영문 이름 |
ethyl 2,3-dihydroxybenzoate; 2,3-Dihydroxy-benzoic acid ethyl ester |
| 분자식 |
C9H10O4 |
| 분자량 |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5,10-11H,2H2,1H3 |
| cas번호 |
3943-73-5 |
| 분자 구조 |
|
| 밀도 |
1.294g/cm3 |
| 녹는 점 |
65℃ |
| 비등점 |
307.2°C at 760 mmHg |
| 굴절 지수 |
1.573 |
| 인화점 |
123°C |
| 증기압 |
0.000406mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|