ChemNet > CAS > 39620-02-5 5-Bromonicotinoyl chloride
39620-02-5 5-Bromonicotinoyl chloride
상품명칭 |
5-Bromonicotinoyl chloride |
별명 |
5-Bromopyridine-3-carbonyl chloride |
분자식 |
C6H3BrClNO |
분자량 |
220.4511 |
InChI |
InChI=1/C6H3BrClNO/c7-5-1-4(6(8)10)2-9-3-5/h1-3H |
cas번호 |
39620-02-5 |
분자 구조 |
|
밀도 |
1.76g/cm3 |
녹는 점 |
75℃ |
비등점 |
265.4°C at 760 mmHg |
굴절 지수 |
1.59 |
인화점 |
114.3°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|