ChemNet > CAS > 39769-09-0 4,4'-Difluorobenzylideneaniline
39769-09-0 4,4'-Difluorobenzylideneaniline
상품명칭 |
4,4'-Difluorobenzylideneaniline |
별명 |
4-fluoro-N-[(1E)-(4-fluorophenyl)methylidene]aniline |
분자식 |
C13H9F2N |
분자량 |
217.2141 |
InChI |
InChI=1/C13H9F2N/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-9H/b16-9+ |
cas번호 |
39769-09-0 |
분자 구조 |
|
밀도 |
1.11g/cm3 |
녹는 점 |
64℃ |
비등점 |
307.4°C at 760 mmHg |
굴절 지수 |
1.527 |
인화점 |
139.7°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|