ChemNet > CAS > 39828-35-8 2,4- dimethoxybenzoyl chloride
39828-35-8 2,4- dimethoxybenzoyl chloride
상품명칭 |
2,4- dimethoxybenzoyl chloride |
별명 |
2,4-DIMETHOXYBENZOYL CHLORIDE; benzoyl chloride, 2,4-dimethoxy- |
분자식 |
C9H9ClO3 |
분자량 |
200.619 |
InChI |
InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
cas번호 |
39828-35-8 |
분자 구조 |
|
밀도 |
1.224g/cm3 |
녹는 점 |
58℃ |
비등점 |
306.7°C at 760 mmHg |
굴절 지수 |
1.52 |
인화점 |
134.1°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|