ChemNet > CAS > 3988-03-2 4,4'-dibromobenzophenone
3988-03-2 4,4'-dibromobenzophenone
| 상품명칭 |
4,4'-dibromobenzophenone |
| 별명 |
Bis(p-bromophenyl) ketone; NSC 86518; p,p'-Dibromobenzophenone; Benzophenone, 4,4'-dibromo- (8CI); Methanone, bis(4-bromophenyl)- (9CI); bis(4-bromophenyl)methanone |
| 분자식 |
C13H8Br2O |
| 분자량 |
340.01 |
| InChI |
InChI=1/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| cas번호 |
3988-03-2 |
| EC번호 |
223-632-0 |
| 분자 구조 |
|
| 밀도 |
1.7g/cm3 |
| 녹는 점 |
171-174℃ |
| 비등점 |
395.6°C at 760 mmHg |
| 굴절 지수 |
1.633 |
| 인화점 |
121°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S22:;
S24/25:;
|
|
