ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
상품명칭 |
3,5-Dichlorophenylhydrazine |
영문 이름 |
3,5-Dichlorophenylhydrazine; |
분자식 |
C6H6Cl2N2 |
분자량 |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
cas번호 |
39943-56-1 |
분자 구조 |
|
밀도 |
1.475g/cm3 |
비등점 |
286.1°C at 760 mmHg |
굴절 지수 |
1.665 |
인화점 |
126.8°C |
증기압 |
0.0027mmHg at 25°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|