ChemNet > CAS > 39978-14-8 Methyl 3-aminothiophene-4-carboxylate hydrochloride
39978-14-8 Methyl 3-aminothiophene-4-carboxylate hydrochloride
상품명칭 |
Methyl 3-aminothiophene-4-carboxylate hydrochloride |
영문 이름 |
Methyl 3-aminothiophene-4-carboxylate hydrochloride; methyl 4-aminothiophene-3-carboxylate hydrochloride; methyl 4-aminothiophene-3-carboxylate |
분자식 |
C6H7NO2S |
분자량 |
157.1903 |
InChI |
InChI=1/C6H7NO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,7H2,1H3 |
cas번호 |
39978-14-8 |
분자 구조 |
|
밀도 |
1.319g/cm3 |
녹는 점 |
203℃ |
비등점 |
295.9°C at 760 mmHg |
굴절 지수 |
1.598 |
인화점 |
132.8°C |
증기압 |
0.00148mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|