ChemNet > CAS > 4004-95-9 1-phenylpiperazine dihydrochloride
4004-95-9 1-phenylpiperazine dihydrochloride
| 상품명칭 |
1-phenylpiperazine dihydrochloride |
| 별명 |
1-Phenylpiperazine dihydrochloride; 1-Phenylpiperazine HCl |
| 분자식 |
C10H16Cl2N2 |
| 분자량 |
235.1534 |
| InChI |
InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
| cas번호 |
4004-95-9 |
| EC번호 |
223-654-0 |
| 분자 구조 |
|
| 비등점 |
287.2°C at 760 mmHg |
| 인화점 |
138.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
