ChemNet > CAS > 403-15-6 4-Fluoro-3-methylbenzoic acid
403-15-6 4-Fluoro-3-methylbenzoic acid
상품명칭 |
4-Fluoro-3-methylbenzoic acid |
영문 이름 |
4-Fluoro-3-methylbenzoic acid; 4-Fluoro-m-toluic acid; 4-fluoro-3-methylbenzoate; 3-methyl-4-Fluorobenzoic acid;
|
분자식 |
C8H6FO2 |
분자량 |
153.131 |
InChI |
InChI=1/C8H7FO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)/p-1 |
cas번호 |
403-15-6 |
분자 구조 |
|
녹는 점 |
166-169℃ |
비등점 |
266.3°C at 760 mmHg |
인화점 |
114.9°C |
증기압 |
0.00434mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|