ChemNet > CAS > 4100-13-4 1,2,3-Thiadiazole-4-carboxylic acid
4100-13-4 1,2,3-Thiadiazole-4-carboxylic acid
상품명칭 |
1,2,3-Thiadiazole-4-carboxylic acid |
별명 |
4-Carboxy-1,2,3-thiadiazole; 1,2,3-thiadiazole-4-carboxylate |
분자식 |
C3HN2O2S |
분자량 |
129.1178 |
InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-8-5-4-2/h1H,(H,6,7)/p-1 |
cas번호 |
4100-13-4 |
분자 구조 |
|
녹는 점 |
227-228℃ |
비등점 |
322.3°C at 760 mmHg |
인화점 |
148.7°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|