ChemNet > CAS > 4104-75-0 N-methyl-N-phenylthiourea
4104-75-0 N-methyl-N-phenylthiourea
상품명칭 |
N-methyl-N-phenylthiourea |
별명 |
1-Methyl-1-phenylthiourea |
분자식 |
C8H10N2S |
분자량 |
166.2434 |
InChI |
InChI=1/C8H10N2S/c1-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
cas번호 |
4104-75-0 |
EC번호 |
223-877-3 |
분자 구조 |
|
밀도 |
1.221g/cm3 |
녹는 점 |
101℃ |
비등점 |
267.1°C at 760 mmHg |
굴절 지수 |
1.679 |
인화점 |
115.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S37/39:Wear suitable gloves and eye/face protection.;
|
|