ChemNet > CAS > 42087-80-9 Methyl 4-Chloro-2-Nitrobenzoate
42087-80-9 Methyl 4-Chloro-2-Nitrobenzoate
| 상품명칭 |
Methyl 4-Chloro-2-Nitrobenzoate |
| 별명 |
4-Chloro-2-nitrobenzoic acid methyl ester |
| 분자식 |
C8H6ClNO4 |
| 분자량 |
215.5905 |
| InChI |
InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3 |
| cas번호 |
42087-80-9 |
| EC번호 |
255-654-1 |
| 분자 구조 |
|
| 밀도 |
1.426g/cm3 |
| 녹는 점 |
43-45℃ |
| 비등점 |
285.6°C at 760 mmHg |
| 굴절 지수 |
1.568 |
| 인화점 |
126.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
