ChemNet > CAS > 4408-60-0 2,4,6-Trimethylphenylacetic acid
4408-60-0 2,4,6-Trimethylphenylacetic acid
상품명칭 |
2,4,6-Trimethylphenylacetic acid |
별명 |
Mesitylacetic acid; Mesityleneacetic acid; Mesity aceti acid; VITAS-BB TBB000369; RARECHEM AL BO 0305; BENZENEACETIC ACID, 2,4,6-TRIMETHYL-; 2,4,6-TRIMETHYLBENZENEACETIC ACID; 2,4,6-TMPAC; 2,4,6-Trimethyl phenylacetic acid; (2,4,6-trimethylphenyl)acetate |
분자식 |
C11H13O2 |
분자량 |
177.2203 |
InChI |
InChI=1/C11H14O2/c1-7-4-8(2)10(6-11(12)13)9(3)5-7/h4-5H,6H2,1-3H3,(H,12,13)/p-1 |
cas번호 |
4408-60-0 |
EC번호 |
224-556-0 |
분자 구조 |
|
녹는 점 |
167-168℃ |
비등점 |
312.9°C at 760 mmHg |
인화점 |
210°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|