ChemNet > CAS > 44520-55-0 D(-)-Threoninol
44520-55-0 D(-)-Threoninol
| 상품명칭 |
D(-)-Threoninol |
| 별명 |
(2R,3R)-2-Amino-1,3-butanediol; D-Threoninol; (2R,3R)-1,3-dihydroxybutan-2-aminium; (2S,3S)-1,3-dihydroxybutan-2-aminium; (2S,3S)-2-aminobutane-1,3-diol |
| 분자식 |
C4H11NO2 |
| 분자량 |
105.1356 |
| InChI |
InChI=1/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m0/s1 |
| cas번호 |
44520-55-0 |
| 분자 구조 |
|
| 밀도 |
1.118g/cm3 |
| 녹는 점 |
57.5-61.5℃ |
| 비등점 |
257.8°C at 760 mmHg |
| 굴절 지수 |
1.488 |
| 인화점 |
109.7°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
