446-22-0 2'-fluoropropiophenone
상품명칭 |
2'-fluoropropiophenone |
영문 이름 |
2'-fluoropropiophenone; 2'-fluoro-1-phenylpropan-1-one; 1-(2'-fluorophenyl)propan-1-one; 2-Fluoropropiophenone |
분자식 |
C9H9FO |
분자량 |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
cas번호 |
446-22-0 |
EC번호 |
244-220-7 |
분자 구조 |
|
밀도 |
1.074g/cm3 |
비등점 |
204.119°C at 760 mmHg |
굴절 지수 |
1.489 |
인화점 |
77.067°C |
증기압 |
0.268mmHg at 25°C |
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|