ChemNet > CAS > 4712-55-4 Diphenyl phosphite
4712-55-4 Diphenyl phosphite
상품명칭 |
Diphenyl phosphite |
별명 |
diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
분자식 |
C12H11O3P |
분자량 |
234.1877 |
InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
cas번호 |
4712-55-4 |
EC번호 |
225-202-8 |
분자 구조 |
|
녹는 점 |
12℃ |
비등점 |
348.233°C at 760 mmHg |
인화점 |
178.834°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|