ChemNet > CAS > 50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
상품명칭 |
(2,4-dimethyl-1,3-thiazol-5-yl)methanol |
별명 |
(2,4-dimethylthiazol-5-yl)methanol;
|
분자식 |
C6H9NOS |
분자량 |
143.2068 |
InChI |
InChI=1/C6H9NOS/c1-4-6(3-8)9-5(2)7-4/h8H,3H2,1-2H3 |
cas번호 |
50382-32-6 |
분자 구조 |
|
밀도 |
1.208g/cm3 |
녹는 점 |
46℃ |
비등점 |
261.965°C at 760 mmHg |
굴절 지수 |
1.569 |
인화점 |
112.233°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|