ChemNet > CAS > 50533-97-6 4-dimethylaminopiperidine
50533-97-6 4-dimethylaminopiperidine
상품명칭 |
4-dimethylaminopiperidine |
별명 |
4-(Dimethylamino)piperidine; N,N-dimethylpiperidin-4-amine |
분자식 |
C7H16N2 |
분자량 |
128.2153 |
InChI |
InChI=1/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3 |
cas번호 |
50533-97-6 |
EC번호 |
256-617-2 |
분자 구조 |
|
밀도 |
0.91g/cm3 |
비등점 |
179.7°C at 760 mmHg |
굴절 지수 |
1.479 |
인화점 |
63.3°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|