ChemNet > CAS > 51362-38-0 6-phenoxynicotinic acid
51362-38-0 6-phenoxynicotinic acid
| 상품명칭 |
6-phenoxynicotinic acid |
| 별명 |
6-phenoxypyridine-3-carboxylic acid |
| 분자식 |
C12H9NO3 |
| 분자량 |
215.2048 |
| InChI |
InChI=1/C12H9NO3/c14-12(15)9-6-7-11(13-8-9)16-10-4-2-1-3-5-10/h1-8H,(H,14,15) |
| cas번호 |
51362-38-0 |
| 분자 구조 |
|
| 밀도 |
1.298g/cm3 |
| 녹는 점 |
164℃ |
| 비등점 |
391.2°C at 760 mmHg |
| 굴절 지수 |
1.613 |
| 인화점 |
190.4°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
