51605-97-1 4-Amino-2-bromocumene
상품명칭 |
4-Amino-2-bromocumene |
영문 이름 |
4-Amino-2-bromocumene; 2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
분자식 |
C9H12BrN |
분자량 |
214.1023 |
InChI |
InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
cas번호 |
51605-97-1 |
분자 구조 |
|
밀도 |
1.355g/cm3 |
비등점 |
271.8°C at 760 mmHg |
굴절 지수 |
1.577 |
인화점 |
118.2°C |
증기압 |
0.00631mmHg at 25°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|