ChemNet > CAS > 527-61-7 2,6-Dimethylbenzoquinone
527-61-7 2,6-Dimethylbenzoquinone
상품명칭 |
2,6-Dimethylbenzoquinone |
분자식 |
C8H8O2 |
분자량 |
136.15 |
InChI |
InChI=1/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
cas번호 |
527-61-7 |
EC번호 |
208-420-8 |
분자 구조 |
|
녹는 점 |
69-74℃ |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|