ChemNet > CAS > 5381-20-4 thianaphthene-3-carboxaldehyde
5381-20-4 thianaphthene-3-carboxaldehyde
상품명칭 |
thianaphthene-3-carboxaldehyde |
영문 이름 |
thianaphthene-3-carboxaldehyde; 1-Benzothiophene-3-carbaldehyde; Benzo[b]thiophene-3-carboxaldehyde |
분자식 |
C9H6OS |
분자량 |
162.2083 |
InChI |
InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
cas번호 |
5381-20-4 |
분자 구조 |
|
밀도 |
1.3g/cm3 |
녹는 점 |
56-58℃ |
비등점 |
303.2°C at 760 mmHg |
굴절 지수 |
1.719 |
인화점 |
137.2°C |
증기압 |
0.000944mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|