CAS No: 5413-60-5, Chemical Name: 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate
the physical and chemical property of 5413-60-5, 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate is provided by ChemNet.com
ChemNet > CAS > 5413-60-5 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate
5413-60-5 3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate
상품명칭 |
3a,4,5,6,7,7a-hexahydro-4,7-methanoinden-6-yl acetate |
별명 |
Jasmacyclene; 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-6-yl acetate; Verdyl Acetate |
분자식 |
C12H16O2 |
분자량 |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-7(13)14-12-6-8-5-11(12)10-4-2-3-9(8)10/h2-3,8-12H,4-6H2,1H3 |
cas번호 |
5413-60-5 |
EC번호 |
226-501-6 |
분자 구조 |
|
밀도 |
1.12g/cm3 |
비등점 |
258.4°C at 760 mmHg |
굴절 지수 |
1.536 |
인화점 |
101.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|