ChemNet > CAS > 556-90-1 Pseudothiohydantoin
556-90-1 Pseudothiohydantoin
상품명칭 |
Pseudothiohydantoin |
별명 |
2-imino-1,3-thiazol-4-one; 2-amino-1,3-thiazol-4(5H)-one; 2-Imino-4-thiazolidinone |
분자식 |
C3H4N2OS |
분자량 |
116.1417 |
InChI |
InChI=1/C3H4N2OS/c4-3-5-2(6)1-7-3/h1H2,(H2,4,5,6) |
cas번호 |
556-90-1 |
EC번호 |
209-145-6 |
분자 구조 |
|
밀도 |
1.78g/cm3 |
녹는 점 |
249℃ |
비등점 |
253.5°C at 760 mmHg |
굴절 지수 |
1.785 |
인화점 |
107.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|