5707-44-8 4-Ethylbiphenyl
상품명칭 |
4-Ethylbiphenyl |
영문 이름 |
4-Ethylbiphenyl;1,1'-Biphenyl, 4-ethyl- (9CI); 1-Ethyl-4-phenylbenzene; NSC 60063; p-Ethylbiphenyl; 1,1'-Biphenyl, 4-ethyl-; Biphenyl, 4-ethyl- (8CI); 2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-oxoethyl biphenyl-4-ylacetate |
분자식 |
C30H27NO5 |
분자량 |
481.5391 |
InChI |
InChI=1/C30H27NO5/c1-20-14-26(21(2)31(20)17-23-10-13-28-29(15-23)36-19-35-28)27(32)18-34-30(33)16-22-8-11-25(12-9-22)24-6-4-3-5-7-24/h3-15H,16-19H2,1-2H3 |
cas번호 |
5707-44-8 |
분자 구조 |
|
밀도 |
1.21g/cm3 |
녹는 점 |
34-35.5℃ |
비등점 |
655.8°C at 760 mmHg |
굴절 지수 |
1.612 |
인화점 |
350.4°C |
증기압 |
4.5E-17mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|