ChemNet > CAS > 579-43-1 1,2-Diphenyl-1,2-ethanediol (meso)
579-43-1 1,2-Diphenyl-1,2-ethanediol (meso)
상품명칭 |
1,2-Diphenyl-1,2-ethanediol (meso) |
영문 이름 |
1,2-Diphenyl-1,2-ethanediol (meso); meso-Hydrobenzoin; meso-1,2-Diphenyl-1,2-ethanediol; (1R,2S)-1,2-diphenylethane-1,2-diol |
분자식 |
C14H14O2 |
분자량 |
214.2598 |
InChI |
InChI=1/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14+ |
cas번호 |
579-43-1 |
EC번호 |
207-758-3 |
분자 구조 |
|
밀도 |
1.193g/cm3 |
녹는 점 |
134-137℃ |
비등점 |
373°C at 760 mmHg |
굴절 지수 |
1.624 |
인화점 |
179.8°C |
증기압 |
3.18E-06mmHg at 25°C |
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|