589-82-2 3-Heptanol
상품명칭 |
3-Heptanol |
영문 이름 |
3-Heptanol; heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
분자식 |
C7H16O |
분자량 |
116.2013 |
InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
cas번호 |
589-82-2 |
EC번호 |
209-661-1 |
분자 구조 |
|
밀도 |
0.818g/cm3 |
녹는 점 |
-70℃ |
비등점 |
156.7°C at 760 mmHg |
굴절 지수 |
1.42 |
인화점 |
54.4°C |
증기압 |
1.03mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|