5949-05-3 L (-) - 시트로넬랄
상품명칭 |
L (-) - 시트로넬랄 |
별명 |
;(S)-(-)-3,7-디메틸-6-옥테날; (S)-()-시트로넬랄; 시트르넬랄; (-)-시트르넬랄; (3S) -3,7- 디메틸 옥트 -6- 에날; (-)-시트로넬랄 |
영문 이름 |
L(-)-Citronellal; (S)-(-)-3,7-Dimethyl-6-octenal; (S)-()-Citronellal; Citrnellal; (-)-Citrnellal; (3S)-3,7-dimethyloct-6-enal; (-)-Citronellal |
분자식 |
C10H18O |
분자량 |
154.2493 |
InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1 |
cas번호 |
5949-05-3 |
EC번호 |
227-707-9 |
분자 구조 |
|
밀도 |
0.835g/cm3 |
비등점 |
208.4°C at 760 mmHg |
굴절 지수 |
1.437 |
인화점 |
75.6°C |
증기압 |
0.215mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|