ChemNet > CAS > 618-76-8 4-hydroxy-3,5-diiodobenzoic acid
618-76-8 4-hydroxy-3,5-diiodobenzoic acid
| 상품명칭 |
4-hydroxy-3,5-diiodobenzoic acid |
| 별명 |
3,5-Diiodo-4-hydroxybenzoic acid |
| 분자식 |
C7H4I2O3 |
| 분자량 |
389.9138 |
| InChI |
InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| cas번호 |
618-76-8 |
| EC번호 |
210-562-0 |
| 분자 구조 |
|
| 밀도 |
2.697g/cm3 |
| 비등점 |
346.4°C at 760 mmHg |
| 굴절 지수 |
1.784 |
| 인화점 |
163.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
