ChemNet > CAS > 620-88-2 4-Nitrophenyl phenyl ether
620-88-2 4-Nitrophenyl phenyl ether
상품명칭 |
4-Nitrophenyl phenyl ether |
별명 |
p-Nitrodiphenyl ether; P-NITRODIPHENYLETHER; 1-nitro-4-phenoxybenzene; methyl 2-[(chloroacetyl)amino]benzoate; 2-chloro-N-(2-fluorophenyl)acetamide; 2-chloro-1-[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]ethanone |
분자식 |
C15H16ClNO |
분자량 |
261.7466 |
InChI |
InChI=1/C15H16ClNO/c1-10-4-6-13(7-5-10)17-11(2)8-14(12(17)3)15(18)9-16/h4-8H,9H2,1-3H3 |
cas번호 |
620-88-2 |
EC번호 |
210-656-1 |
분자 구조 |
|
밀도 |
1.12g/cm3 |
녹는 점 |
53-56℃ |
비등점 |
399.6°C at 760 mmHg |
굴절 지수 |
1.564 |
인화점 |
195.4°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|