ChemNet > CAS > 621-54-5 3-(3-Hydroxyphenyl)propionic acid
621-54-5 3-(3-Hydroxyphenyl)propionic acid
| 상품명칭 |
3-(3-Hydroxyphenyl)propionic acid |
| 별명 |
3-Hydroxyhydrocinnamic acid; 3-Hydroxyphenyl-propionic acid; 3-(3-hydroxyphenyl)propanoic acid |
| 분자식 |
C9H10O3 |
| 분자량 |
166.1739 |
| InChI |
InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| cas번호 |
621-54-5 |
| EC번호 |
210-692-8 |
| 분자 구조 |
|
| 밀도 |
1.26g/cm3 |
| 비등점 |
354.5°C at 760 mmHg |
| 굴절 지수 |
1.58 |
| 인화점 |
182.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
