ChemNet > CAS > 621-63-6 2,2-diethoxyethanol
621-63-6 2,2-diethoxyethanol
상품명칭 |
2,2-diethoxyethanol |
별명 |
Hydroxyacetaldehyde diethyl acetal; 2,2-diethoxy ethanol; glycolaldehyde diethyl acetal |
분자식 |
C6H14O3 |
분자량 |
134.1736 |
InChI |
InChI=1/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3 |
cas번호 |
621-63-6 |
EC번호 |
210-697-5 |
분자 구조 |
|
밀도 |
0.97g/cm3 |
비등점 |
167°C at 760 mmHg |
굴절 지수 |
1.418 |
인화점 |
68.4°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|