ChemNet > CAS > 621-91-0 1,4-dibenzyloxybenzene
621-91-0 1,4-dibenzyloxybenzene
상품명칭 |
1,4-dibenzyloxybenzene |
별명 |
Dibenzyloxybenzene,98%; quinol dibenzyl ether; 1,4-Bis(phenylmethoxy)benzene; Hydroquinone dibenzyl ether; 1,4-bis(benzyloxy)benzene |
분자식 |
C20H18O2 |
분자량 |
290.3557 |
InChI |
InChI=1/C20H18O2/c1-3-7-17(8-4-1)15-21-19-11-13-20(14-12-19)22-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
cas번호 |
621-91-0 |
EC번호 |
210-714-6 |
분자 구조 |
|
밀도 |
1.121g/cm3 |
비등점 |
441.7°C at 760 mmHg |
굴절 지수 |
1.6 |
인화점 |
173.4°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|