ChemNet > CAS > 622-20-8 1,2-Bis(phenylthio)ethane
622-20-8 1,2-Bis(phenylthio)ethane
상품명칭 |
1,2-Bis(phenylthio)ethane |
별명 |
1,2-Bis(phenylthio)ethane,98%; 1,1'-(ethane-1,2-diyldisulfanediyl)dibenzene |
분자식 |
C14H14S2 |
분자량 |
246.391 |
InChI |
InChI=1/C14H14S2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
cas번호 |
622-20-8 |
EC번호 |
210-723-5 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
비등점 |
377.3°C at 760 mmHg |
굴절 지수 |
1.646 |
인화점 |
184.6°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|