ChemNet > CAS > 626-27-7 Heptanoic anhydride
626-27-7 Heptanoic anhydride
상품명칭 |
Heptanoic anhydride |
별명 |
Enanthicanhydride; Oenanthic anhydride; Enanthic anhydride |
분자식 |
C14H26O3 |
분자량 |
242.3544 |
InChI |
InChI=1/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
cas번호 |
626-27-7 |
EC번호 |
210-940-5 |
분자 구조 |
|
밀도 |
0.931g/cm3 |
녹는 점 |
-12℃ |
비등점 |
269.5°C at 760 mmHg |
굴절 지수 |
1.44 |
인화점 |
129.9°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|