ChemNet > CAS > 6290-17-1 Ethyl acetoacetate propylene glycol ketal
6290-17-1 Ethyl acetoacetate propylene glycol ketal
상품명칭 |
Ethyl acetoacetate propylene glycol ketal |
별명 |
2,4-Dimethyl-1,3-dioxolane-2-acetic acid ethyl ester~Ethyl 2,4-dimethyl-1,3-dioxolane-2-acetate; Acetoacetic acid ethyl ester 1,2-propylene ketal; ethyl (2,4-dimethyl-1,3-dioxolan-2-yl)acetate |
분자식 |
C9H16O4 |
분자량 |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-4-11-8(10)5-9(3)12-6-7(2)13-9/h7H,4-6H2,1-3H3 |
cas번호 |
6290-17-1 |
EC번호 |
228-536-2 |
분자 구조 |
|
밀도 |
1.026g/cm3 |
비등점 |
220.6°C at 760 mmHg |
굴절 지수 |
1.423 |
인화점 |
86.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|