62936-23-6 5-Chlorovanillic acid
| 상품명칭 |
5-Chlorovanillic acid |
| 영문 이름 |
5-Chlorovanillic acid; 5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
| 분자식 |
C8H7ClO4 |
| 분자량 |
202.5918 |
| InChI |
InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
| cas번호 |
62936-23-6 |
| EC번호 |
263-766-7 |
| 분자 구조 |
|
| 밀도 |
1.485g/cm3 |
| 녹는 점 |
241-243℃ |
| 비등점 |
352.3°C at 760 mmHg |
| 굴절 지수 |
1.599 |
| 인화점 |
166.9°C |
| 증기압 |
1.44E-05mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|