ChemNet > CAS > 63435-16-5 Methyl 4-amino-3-hydroxybenzoate
63435-16-5 Methyl 4-amino-3-hydroxybenzoate
| 상품명칭 |
Methyl 4-amino-3-hydroxybenzoate |
| 별명 |
4-Amino-3-hydroxybenzoic acid methyl ester |
| 분자식 |
C8H9NO3 |
| 분자량 |
167.162 |
| InChI |
InChI=1/C8H9NO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,9H2,1H3 |
| cas번호 |
63435-16-5 |
| 분자 구조 |
|
| 밀도 |
1.305g/cm3 |
| 비등점 |
364.5°C at 760 mmHg |
| 굴절 지수 |
1.605 |
| 인화점 |
174.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
