ChemNet > CAS > 637-39-8 Triethanolamine hydrochloride
637-39-8 Triethanolamine hydrochloride
| 상품명칭 |
Triethanolamine hydrochloride |
| 별명 |
2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride; triethanolamine hcl; tris(2-hydroxyethyl)ammonium chloride; 2,2',2''-nitrilotriethanol hydrochloride (1:1) |
| 분자식 |
C6H16ClNO3 |
| 분자량 |
185.6491 |
| InChI |
InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
| cas번호 |
637-39-8 |
| EC번호 |
211-284-2 |
| 분자 구조 |
|
| 녹는 점 |
177-179℃ |
| 비등점 |
335.4°C at 760 mmHg |
| 인화점 |
185°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
