ChemNet > CAS > 6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
상품명칭 |
1-(2,6-Dimethylphenyl)-thiourea |
별명 |
2,6-Dimethylphenylthiourea |
분자식 |
C9H12N2S |
분자량 |
180.27 |
InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-7(2)8(6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
cas번호 |
6396-76-5 |
EC번호 |
229-005-8 |
분자 구조 |
|
밀도 |
1.2g/cm3 |
비등점 |
284.4°C at 760 mmHg |
굴절 지수 |
1.674 |
인화점 |
125.8°C |
위험성 표시 |
|
리스크 규칙 |
R25:Toxic if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|