ChemNet > CAS > 644-13-3 2'-benzonaphthone
644-13-3 2'-benzonaphthone
| 상품명칭 |
2'-benzonaphthone |
| 별명 |
Methanone, 2-naphthalenylphenyl-; 2-Benzonaphthone; 2-Benzoylnaphthalene; 2-Naphthyl phenyl ketone; Ketone, 2-naphthyl phenyl; NSC 5190; beta-Benzoylnaphthalene; 2'-Benzonaphthone; naphthalen-2-yl(phenyl)methanone |
| 분자식 |
C17H12O |
| 분자량 |
232.2766 |
| InChI |
InChI=1/C17H12O/c18-17(14-7-2-1-3-8-14)16-11-10-13-6-4-5-9-15(13)12-16/h1-12H |
| cas번호 |
644-13-3 |
| EC번호 |
211-410-6 |
| 분자 구조 |
|
| 밀도 |
1.151g/cm3 |
| 녹는 점 |
76-82℃ |
| 비등점 |
384.1°C at 760 mmHg |
| 굴절 지수 |
1.653 |
| 인화점 |
174.7°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
